C15H22O5 — CID 10334070
methyl (1R,2R,3S,10S)-2,10-dideuterio-3-ethenyl-1-methoxy-4,4-dimethyl-5,9-dioxatricyclo[4.3.1.03,10]decane-2-carboxylate (PubChem CID 10334070) has the molecular formula C15H22O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl (1R,2R,3S,10S)-2,10-dideuterio-3-ethenyl-1-methoxy-4,4-dimethyl-5,9-dioxatricyclo[4.3.1.03,10]decane-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,10S)-2,10-dideuterio-3-ethenyl-1-methoxy-4,4-dimethyl-5,9-dioxatricyclo[4.3.1.03,10]decane-2-carboxylate |
|---|---|
| PubChem CID | 10334070 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl (1R,2R,3S,10S)-2,10-dideuterio-3-ethenyl-1-methoxy-4,4-dimethyl-5,9-dioxatricyclo[4.3.1.03,10]decane-2-carboxylate |
| SMILES | [2H][C@]1(C(=O)OC)[C@]2(OC)OCCC3OC(C)(C)[C@@]1(C=C)[C@@]32[2H] |
| InChI | InChI=1S/C15H22O5/c1-6-14-10-9(20-13(14,2)3)7-8-19-15(10,18-5)11(14)12(16)17-4/h6,9-11H,1,7-8H2,2-5H3/t9?,10-,11-,14+,15-/m1/s1/i10D,11D |
| InChIKey | RGMKOVRBVVXBDN-KAXYIYBMSA-N |
| XLogP | 1.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|