C24H42O8 — CID 101352347
(4R,5R)-5-[(1S)-2-[(4S,5S,6R)-6-[(2R)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-methoxyethyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one (PubChem CID 101352347) has the molecular formula C24H42O8 and a molecular weight of 458.59 g/mol. Its IUPAC name is (4R,5R)-5-[(1S)-2-[(4S,5S,6R)-6-[(2R)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-methoxyethyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one.
| Compound Name | (4R,5R)-5-[(1S)-2-[(4S,5S,6R)-6-[(2R)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-methoxyethyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 101352347 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (4R,5R)-5-[(1S)-2-[(4S,5S,6R)-6-[(2R)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-methoxyethyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one |
| SMILES | C=C[C@@H](C)[C@H]1OC(C)(C)O[C@@H](C[C@H](OC)[C@H]2OC(=O)C(C)(C)[C@H]2OCOCCOC)[C@@H]1C |
| InChI | InChI=1S/C24H42O8/c1-10-15(2)19-16(3)17(31-24(6,7)32-19)13-18(27-9)20-21(23(4,5)22(25)30-20)29-14-28-12-11-26-8/h10,15-21H,1,11-14H2,2-9H3/t15-,16+,17+,18+,19-,20-,21+/m1/s1 |
| InChIKey | PXVWCGNPZBLKGV-BOHRTUCQSA-N |
| XLogP | 3.33 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|