C12H22O5 — CID 117070726
[3-[(1S,2R)-1-(2-methoxyethoxymethoxy)-2-methylbut-3-enyl]oxiran-2-yl]methanol (PubChem CID 117070726) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is [3-[(1S,2R)-1-(2-methoxyethoxymethoxy)-2-methylbut-3-enyl]oxiran-2-yl]methanol.
| Compound Name | [3-[(1S,2R)-1-(2-methoxyethoxymethoxy)-2-methylbut-3-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 117070726 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [3-[(1S,2R)-1-(2-methoxyethoxymethoxy)-2-methylbut-3-enyl]oxiran-2-yl]methanol |
| SMILES | C=C[C@@H](C)[C@H](OCOCCOC)C1OC1CO |
| InChI | InChI=1S/C12H22O5/c1-4-9(2)11(12-10(7-13)17-12)16-8-15-6-5-14-3/h4,9-13H,1,5-8H2,2-3H3/t9-,10?,11+,12?/m1/s1 |
| InChIKey | MDNXFYGLCTXUKL-ZYGVAYEYSA-N |
| XLogP | 0.57 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|