C28H44O6 — CID 101379241
(4S,5S,6R)-4-[(2R,3R)-3-[(2S,4R,6R)-4-ethenyl-6-phenylmethoxy-1,3-dioxan-2-yl]-2-methoxybutyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane (PubChem CID 101379241) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is (4S,5S,6R)-4-[(2R,3R)-3-[(2S,4R,6R)-4-ethenyl-6-phenylmethoxy-1,3-dioxan-2-yl]-2-methoxybutyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane.
| Compound Name | (4S,5S,6R)-4-[(2R,3R)-3-[(2S,4R,6R)-4-ethenyl-6-phenylmethoxy-1,3-dioxan-2-yl]-2-methoxybutyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 101379241 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | (4S,5S,6R)-4-[(2R,3R)-3-[(2S,4R,6R)-4-ethenyl-6-phenylmethoxy-1,3-dioxan-2-yl]-2-methoxybutyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane |
| SMILES | C=C[C@H]1C[C@H](OCc2ccccc2)O[C@@H]([C@H](C)[C@@H](C[C@@H]2OC(C)(C)O[C@H](C(C)C)[C@H]2C)OC)O1 |
| InChI | InChI=1S/C28H44O6/c1-9-22-15-25(30-17-21-13-11-10-12-14-21)32-27(31-22)20(5)23(29-8)16-24-19(4)26(18(2)3)34-28(6,7)33-24/h9-14,18-20,22-27H,1,15-17H2,2-8H3/t19-,20+,22-,23+,24-,25+,26+,27-/m0/s1 |
| InChIKey | MWLWFRKAEMIVCD-SWVZTFLDSA-N |
| XLogP | 5.70 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|