C17H21Cl3N2O4 — CID 1042540
N-[(2S)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]morpholine-4-carboxamide (PubChem CID 1042540) has the molecular formula C17H21Cl3N2O4 and a molecular weight of 423.72 g/mol. Its IUPAC name is N-[(2S)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 1042540 |
| Molecular Formula | C17H21Cl3N2O4 |
| Molecular Weight | 423.72 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-[(2S)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]morpholine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)O[C@](NC(=O)N1CCOCC1)(C(Cl)(Cl)Cl)O2 |
| InChI | InChI=1S/C17H21Cl3N2O4/c1-15(2,3)11-4-5-12-13(10-11)26-17(25-12,16(18,19)20)21-14(23)22-6-8-24-9-7-22/h4-5,10H,6-9H2,1-3H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | ZYCMRMDFVAHZPL-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|