C15H26O5Si — CID 10425803
[(3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 10425803) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is [(3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [(3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 10425803 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [(3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@H](C1)OC(=O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26O5Si/c1-9(16)18-10-7-11-12(8-10)19-14(17)13(11)20-21(5,6)15(2,3)4/h10-13H,7-8H2,1-6H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | ABVIMXSCWTWTNR-FVCCEPFGSA-N |
| XLogP | 2.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|