C16H28O6Si — CID 135017519
ethyl (3aR,4S,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2-oxo-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4-carboxylate (PubChem CID 135017519) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is ethyl (3aR,4S,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2-oxo-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4-carboxylate.
| Compound Name | ethyl (3aR,4S,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2-oxo-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 135017519 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl (3aR,4S,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2-oxo-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(=O)O[C@]12C |
| InChI | InChI=1S/C16H28O6Si/c1-8-19-13(17)10-9-11(22-23(6,7)15(2,3)4)12-16(10,5)21-14(18)20-12/h10-12H,8-9H2,1-7H3/t10-,11-,12+,16-/m1/s1 |
| InChIKey | UQIIEQWFERKESF-LSSIXWDNSA-N |
| XLogP | 3.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|