C19H36O5Si — CID 164674790
methyl 3-[(3aR,4R,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]propanoate (PubChem CID 164674790) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is methyl 3-[(3aR,4R,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]propanoate.
| Compound Name | methyl 3-[(3aR,4R,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]propanoate |
|---|---|
| PubChem CID | 164674790 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | methyl 3-[(3aR,4R,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]propanoate |
| SMILES | CCOC1C[C@@H]2[C@@H](CCC(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2O1 |
| InChI | InChI=1S/C19H36O5Si/c1-8-22-18-11-14-13(9-10-17(20)21-5)16(12-15(14)23-18)24-25(6,7)19(2,3)4/h13-16,18H,8-12H2,1-7H3/t13-,14-,15+,16+,18?/m1/s1 |
| InChIKey | GHVFNZIVCSATMS-SNEBPLELSA-N |
| XLogP | 4.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|