C29H52F2O5Si — CID 141245901
(3aR,4R,5R,6aS)-4-[3-[2,2-dimethylpropyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 141245901) has the molecular formula C29H52F2O5Si and a molecular weight of 546.81 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[3-[2,2-dimethylpropyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[3-[2,2-dimethylpropyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 141245901 |
| Molecular Formula | C29H52F2O5Si |
| Molecular Weight | 546.81 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[3-[2,2-dimethylpropyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCCC(F)(F)C(CC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC1CCCCO1)O[Si](C)(C)CC(C)(C)C |
| InChI | InChI=1S/C29H52F2O5Si/c1-7-8-9-11-16-29(30,31)25(36-37(5,6)20-28(2,3)4)15-14-21-22-18-26(32)34-24(22)19-23(21)35-27-13-10-12-17-33-27/h21-25,27H,7-20H2,1-6H3/t21-,22-,23-,24+,25?,27?/m1/s1 |
| InChIKey | HRMKWUGCFUTJKY-DSVRWJICSA-N |
| XLogP | 7.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.81 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|