C26H46F2O5Si — CID 18652544
(3aR,4R,5R,6aS)-4-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18652544) has the molecular formula C26H46F2O5Si and a molecular weight of 504.73 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18652544 |
| Molecular Formula | C26H46F2O5Si |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC(F)(F)C(CCC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46F2O5Si/c1-7-14-26(27,28)22(33-34(5,6)25(2,3)4)12-10-11-18-19-16-23(29)31-21(19)17-20(18)32-24-13-8-9-15-30-24/h18-22,24H,7-17H2,1-6H3/t18-,19-,20-,21+,22?,24?/m1/s1 |
| InChIKey | BTCPUVYXKOWRRJ-YFWTZOCMSA-N |
| XLogP | 6.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|