C19H32F2O5Si — CID 15337130
(3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(oxan-2-yloxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 15337130) has the molecular formula C19H32F2O5Si and a molecular weight of 406.54 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(oxan-2-yloxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(oxan-2-yloxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 15337130 |
| Molecular Formula | C19H32F2O5Si |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(oxan-2-yloxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H]2[C@H](C[C@H]1OC1CCCCO1)OC(=O)C2(F)F |
| InChI | InChI=1S/C19H32F2O5Si/c1-18(2,3)27(4,5)24-11-12-13(25-15-8-6-7-9-23-15)10-14-16(12)19(20,21)17(22)26-14/h12-16H,6-11H2,1-5H3/t12-,13+,14-,15?,16+/m0/s1 |
| InChIKey | LQAZRTOVWHWJPK-YSEJDXQZSA-N |
| XLogP | 4.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|