C19H14ClN3 — CID 10426117
5-[(3-chlorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine (PubChem CID 10426117) has the molecular formula C19H14ClN3 and a molecular weight of 319.80 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine.
| Compound Name | 5-[(3-chlorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 10426117 |
| Molecular Formula | C19H14ClN3 |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine |
| SMILES | Clc1cccc(Cn2ccc3nc(-c4ccccc4)nc-3c2)c1 |
| InChI | InChI=1S/C19H14ClN3/c20-16-8-4-5-14(11-16)12-23-10-9-17-18(13-23)22-19(21-17)15-6-2-1-3-7-15/h1-11,13H,12H2 |
| InChIKey | HMUAZDHMCQGIHU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |