C22H27NO2 — CID 10427203
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-4-yl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10427203) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-4-yl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-4-yl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10427203 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-4-yl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cocn3)=CC[C@@H]12 |
| InChI | InChI=1S/C22H27NO2/c1-21-9-7-15(24)11-14(21)3-4-16-17-5-6-19(20-12-25-13-23-20)22(17,2)10-8-18(16)21/h6,11-13,16-18H,3-5,7-10H2,1-2H3/t16-,17-,18-,21-,22-/m0/s1 |
| InChIKey | WZPBPCUFAICWPJ-SPAGYVKCSA-N |
| XLogP | 5.20 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |