C17H12FNO4S — CID 10427648
2-[(4-fluorophenyl)sulfonylamino]naphthalene-1-carboxylic acid (PubChem CID 10427648) has the molecular formula C17H12FNO4S and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]naphthalene-1-carboxylic acid.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 10427648 |
| Molecular Formula | C17H12FNO4S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1c(NS(=O)(=O)c2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C17H12FNO4S/c18-12-6-8-13(9-7-12)24(22,23)19-15-10-5-11-3-1-2-4-14(11)16(15)17(20)21/h1-10,19H,(H,20,21) |
| InChIKey | KIYWIXCUCALPGQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |