C21H22N2O3 — CID 10427954
1-(3-benzoyl-6-methoxyindazol-1-yl)-3,3-dimethylbutan-2-one (PubChem CID 10427954) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(3-benzoyl-6-methoxyindazol-1-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(3-benzoyl-6-methoxyindazol-1-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 10427954 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(3-benzoyl-6-methoxyindazol-1-yl)-3,3-dimethylbutan-2-one |
| SMILES | COc1ccc2c(C(=O)c3ccccc3)nn(CC(=O)C(C)(C)C)c2c1 |
| InChI | InChI=1S/C21H22N2O3/c1-21(2,3)18(24)13-23-17-12-15(26-4)10-11-16(17)19(22-23)20(25)14-8-6-5-7-9-14/h5-12H,13H2,1-4H3 |
| InChIKey | WRCQLSNKTOWYNJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |