C30H41N2O7P — CID 11512544
ditert-butyl [4-[1-(3,3-dimethyl-2-oxobutyl)-6-methoxyindazole-3-carbonyl]phenyl]methyl phosphate (PubChem CID 11512544) has the molecular formula C30H41N2O7P and a molecular weight of 572.64 g/mol. Its IUPAC name is ditert-butyl [4-[1-(3,3-dimethyl-2-oxobutyl)-6-methoxyindazole-3-carbonyl]phenyl]methyl phosphate.
| Compound Name | ditert-butyl [4-[1-(3,3-dimethyl-2-oxobutyl)-6-methoxyindazole-3-carbonyl]phenyl]methyl phosphate |
|---|---|
| PubChem CID | 11512544 |
| Molecular Formula | C30H41N2O7P |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | ditert-butyl [4-[1-(3,3-dimethyl-2-oxobutyl)-6-methoxyindazole-3-carbonyl]phenyl]methyl phosphate |
| SMILES | COc1ccc2c(C(=O)c3ccc(COP(=O)(OC(C)(C)C)OC(C)(C)C)cc3)nn(CC(=O)C(C)(C)C)c2c1 |
| InChI | InChI=1S/C30H41N2O7P/c1-28(2,3)25(33)18-32-24-17-22(36-10)15-16-23(24)26(31-32)27(34)21-13-11-20(12-14-21)19-37-40(35,38-29(4,5)6)39-30(7,8)9/h11-17H,18-19H2,1-10H3 |
| InChIKey | SJCYIGQMIUKABY-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|