C22H16O5 — CID 10428583
4-[(1,8-dihydroxy-9-oxo-10H-anthracen-2-yl)methyl]benzoic acid (PubChem CID 10428583) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-[(1,8-dihydroxy-9-oxo-10H-anthracen-2-yl)methyl]benzoic acid.
| Compound Name | 4-[(1,8-dihydroxy-9-oxo-10H-anthracen-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 10428583 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-[(1,8-dihydroxy-9-oxo-10H-anthracen-2-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccc3c(c2O)C(=O)c2c(O)cccc2C3)cc1 |
| InChI | InChI=1S/C22H16O5/c23-17-3-1-2-14-11-15-8-9-16(20(24)19(15)21(25)18(14)17)10-12-4-6-13(7-5-12)22(26)27/h1-9,23-24H,10-11H2,(H,26,27) |
| InChIKey | RTDKVRGMJUYJST-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |