C21H25NO3S — CID 10429315
[3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 10429315) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is [3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 10429315 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | COc1ccc(C2CCN(C(=O)c3cccs3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H25NO3S/c1-24-18-9-8-15(13-19(18)25-17-5-2-3-6-17)16-10-11-22(14-16)21(23)20-7-4-12-26-20/h4,7-9,12-13,16-17H,2-3,5-6,10-11,14H2,1H3 |
| InChIKey | RYRJQCVOJFPZTR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |