C20H22N4O2S — CID 10429998
1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine (PubChem CID 10429998) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine.
| Compound Name | 1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 10429998 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)Nc1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C20H22N4O2S/c1-21-19(22-2)24-20-23-17(13-5-9-15(25-3)10-6-13)18(27-20)14-7-11-16(26-4)12-8-14/h5-12H,1-4H3,(H2,21,22,23,24) |
| InChIKey | RTQNJXIWXIWJQK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|