C12H16ClF8NO2Si — CID 10432336
[5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-ethyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane (PubChem CID 10432336) has the molecular formula C12H16ClF8NO2Si and a molecular weight of 421.79 g/mol. Its IUPAC name is [5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-ethyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane.
| Compound Name | [5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-ethyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10432336 |
| Molecular Formula | C12H16ClF8NO2Si |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | [5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-ethyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane |
| SMILES | CCC1=NOC(O[Si](C)(C)C)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C12H16ClF8NO2Si/c1-5-7-6-8(23-22-7,24-25(2,3)4)9(14,15)10(16,17)11(18,19)12(13,20)21/h5-6H2,1-4H3 |
| InChIKey | CLHIUVZSJOROIJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|