C13H14ClF12NO2Si — CID 10346141
[5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane (PubChem CID 10346141) has the molecular formula C13H14ClF12NO2Si and a molecular weight of 507.78 g/mol. Its IUPAC name is [5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane.
| Compound Name | [5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10346141 |
| Molecular Formula | C13H14ClF12NO2Si |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | [5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-yl]oxy-trimethylsilane |
| SMILES | CC1=NOC(O[Si](C)(C)C)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C13H14ClF12NO2Si/c1-6-5-7(28-27-6,29-30(2,3)4)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(14,25)26/h5H2,1-4H3 |
| InChIKey | KIOPMUWBSPLUTN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|