C11H8ClF12NO2 — CID 10026741
5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-ethyl-4H-1,2-oxazol-5-ol (PubChem CID 10026741) has the molecular formula C11H8ClF12NO2 and a molecular weight of 449.62 g/mol. Its IUPAC name is 5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-ethyl-4H-1,2-oxazol-5-ol.
| Compound Name | 5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-ethyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 10026741 |
| Molecular Formula | C11H8ClF12NO2 |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | 5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-ethyl-4H-1,2-oxazol-5-ol |
| SMILES | CCC1=NOC(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C11H8ClF12NO2/c1-2-4-3-5(26,27-25-4)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(12,23)24/h26H,2-3H2,1H3 |
| InChIKey | BHJDNPNERZKZTK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|