C10H6ClF12NO2 — CID 10252436
5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-ol (PubChem CID 10252436) has the molecular formula C10H6ClF12NO2 and a molecular weight of 435.59 g/mol. Its IUPAC name is 5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-ol.
| Compound Name | 5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 10252436 |
| Molecular Formula | C10H6ClF12NO2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 5-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3-methyl-4H-1,2-oxazol-5-ol |
| SMILES | CC1=NOC(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C10H6ClF12NO2/c1-3-2-4(25,26-24-3)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(11,22)23/h25H,2H2,1H3 |
| InChIKey | XTMNPXDFPACQSV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|