C8H6F9NO2 — CID 15352260
3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4H-1,2-oxazol-5-ol (PubChem CID 15352260) has the molecular formula C8H6F9NO2 and a molecular weight of 319.12 g/mol. Its IUPAC name is 3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 15352260 |
| Molecular Formula | C8H6F9NO2 |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4H-1,2-oxazol-5-ol |
| SMILES | CC1=NOC(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H6F9NO2/c1-3-2-4(19,20-18-3)5(9,10)6(11,12)7(13,14)8(15,16)17/h19H,2H2,1H3 |
| InChIKey | CRCUYVKYHGSHTO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|