About (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol
(5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 1402754) has the molecular formula C5H6F3NO2
and a molecular weight of 169.10 g/mol. Its IUPAC name is (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
Analyze (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The IUPAC name of (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (CID 1402754) is (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
What is the SMILES notation for (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The canonical SMILES for (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is CC1=NO[C@@](O)(C(F)(F)F)C1.
What is the InChIKey of (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The InChIKey is KKEUGGZODLCCTR-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H6F3NO2/c1-3-2-4(10,11-9-3)5(6,7)8/h10H,2H2,1H3/t4-/m1/s1.
What are the key properties of (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
(5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol has a molecular weight of 169.10 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is sourced from PubChem (CID 1402754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).