C5H5F3N2O3 — CID 138756299
4-hydroxyimino-3-methyl-5-(trifluoromethyl)-1,2-oxazol-5-ol (PubChem CID 138756299) has the molecular formula C5H5F3N2O3 and a molecular weight of 198.10 g/mol. Its IUPAC name is 4-hydroxyimino-3-methyl-5-(trifluoromethyl)-1,2-oxazol-5-ol.
| Compound Name | 4-hydroxyimino-3-methyl-5-(trifluoromethyl)-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 138756299 |
| Molecular Formula | C5H5F3N2O3 |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 4-hydroxyimino-3-methyl-5-(trifluoromethyl)-1,2-oxazol-5-ol |
| SMILES | CC1=NOC(O)(C(F)(F)F)C1=NO |
| InChI | InChI=1S/C5H5F3N2O3/c1-2-3(9-12)4(11,13-10-2)5(6,7)8/h11-12H,1H3 |
| InChIKey | SSPJJGXSQZRZIY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|