C7H6F7NO2 — CID 134108573
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methyl-4H-1,2-oxazol-5-ol (PubChem CID 134108573) has the molecular formula C7H6F7NO2 and a molecular weight of 269.12 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methyl-4H-1,2-oxazol-5-ol.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 134108573 |
| Molecular Formula | C7H6F7NO2 |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methyl-4H-1,2-oxazol-5-ol |
| SMILES | CC1=NOC(O)(C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H6F7NO2/c1-3-2-4(16,17-15-3)5(8,9)6(10,11)7(12,13)14/h16H,2H2,1H3 |
| InChIKey | YEUVCUXTVDRUPJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|