C6H6BrF4NO2 — CID 10107682
5-(2-bromo-1,1,2,2-tetrafluoroethyl)-3-methyl-4H-1,2-oxazol-5-ol (PubChem CID 10107682) has the molecular formula C6H6BrF4NO2 and a molecular weight of 280.01 g/mol. Its IUPAC name is 5-(2-bromo-1,1,2,2-tetrafluoroethyl)-3-methyl-4H-1,2-oxazol-5-ol.
| Compound Name | 5-(2-bromo-1,1,2,2-tetrafluoroethyl)-3-methyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 10107682 |
| Molecular Formula | C6H6BrF4NO2 |
| Molecular Weight | 280.01 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 5-(2-bromo-1,1,2,2-tetrafluoroethyl)-3-methyl-4H-1,2-oxazol-5-ol |
| SMILES | CC1=NOC(O)(C(F)(F)C(F)(F)Br)C1 |
| InChI | InChI=1S/C6H6BrF4NO2/c1-3-2-4(13,14-12-3)5(8,9)6(7,10)11/h13H,2H2,1H3 |
| InChIKey | CTRMCJMONJZCHG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.01 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|