C8H6ClF8NO2 — CID 10065557
5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-methyl-4H-1,2-oxazol-5-ol (PubChem CID 10065557) has the molecular formula C8H6ClF8NO2 and a molecular weight of 335.58 g/mol. Its IUPAC name is 5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-methyl-4H-1,2-oxazol-5-ol.
| Compound Name | 5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-methyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 10065557 |
| Molecular Formula | C8H6ClF8NO2 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-3-methyl-4H-1,2-oxazol-5-ol |
| SMILES | CC1=NOC(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C8H6ClF8NO2/c1-3-2-4(19,20-18-3)5(10,11)6(12,13)7(14,15)8(9,16)17/h19H,2H2,1H3 |
| InChIKey | VYXJIBUDMSYIRO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|