C21H22F3NO5 — CID 10432525
2-[[4-methoxy-3-[[4-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]methyl]butanoic acid (PubChem CID 10432525) has the molecular formula C21H22F3NO5 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[[4-methoxy-3-[[4-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]methyl]butanoic acid.
| Compound Name | 2-[[4-methoxy-3-[[4-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 10432525 |
| Molecular Formula | C21H22F3NO5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[[4-methoxy-3-[[4-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]methyl]butanoic acid |
| SMILES | CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OC(F)(F)F)cc2)c1)C(=O)O |
| InChI | InChI=1S/C21H22F3NO5/c1-3-15(20(27)28)10-14-6-9-18(29-2)17(11-14)19(26)25-12-13-4-7-16(8-5-13)30-21(22,23)24/h4-9,11,15H,3,10,12H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | ZIUZYSIAUTXUHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |