C24H15ClN2O4 — CID 10432873
2-[5-chloro-1-[4-[(4-cyanophenyl)methoxy]phenyl]indol-3-yl]-2-oxoacetic acid (PubChem CID 10432873) has the molecular formula C24H15ClN2O4 and a molecular weight of 430.85 g/mol. Its IUPAC name is 2-[5-chloro-1-[4-[(4-cyanophenyl)methoxy]phenyl]indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-chloro-1-[4-[(4-cyanophenyl)methoxy]phenyl]indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 10432873 |
| Molecular Formula | C24H15ClN2O4 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-[5-chloro-1-[4-[(4-cyanophenyl)methoxy]phenyl]indol-3-yl]-2-oxoacetic acid |
| SMILES | N#Cc1ccc(COc2ccc(-n3cc(C(=O)C(=O)O)c4cc(Cl)ccc43)cc2)cc1 |
| InChI | InChI=1S/C24H15ClN2O4/c25-17-5-10-22-20(11-17)21(23(28)24(29)30)13-27(22)18-6-8-19(9-7-18)31-14-16-3-1-15(12-26)2-4-16/h1-11,13H,14H2,(H,29,30) |
| InChIKey | YCQIIUPGJUMKNI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|