C24H18N2O5S — CID 58437388
4-[3-cyano-5-[(4-methylsulfonylphenyl)methoxy]indol-1-yl]benzoic acid (PubChem CID 58437388) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is 4-[3-cyano-5-[(4-methylsulfonylphenyl)methoxy]indol-1-yl]benzoic acid.
| Compound Name | 4-[3-cyano-5-[(4-methylsulfonylphenyl)methoxy]indol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 58437388 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-[3-cyano-5-[(4-methylsulfonylphenyl)methoxy]indol-1-yl]benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(COc2ccc3c(c2)c(C#N)cn3-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H18N2O5S/c1-32(29,30)21-9-2-16(3-10-21)15-31-20-8-11-23-22(12-20)18(13-25)14-26(23)19-6-4-17(5-7-19)24(27)28/h2-12,14H,15H2,1H3,(H,27,28) |
| InChIKey | FZOFBBDZAXLMGZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |