ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate

C20H18N2O4S — CID 58437251

IUPACethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate
SMILESCCOC(=O)c1ccc(-n2cc(C#N)c3cc(CS(C)(=O)=O)ccc32)cc1
InChIInChI=1S/C20H18N2O4S/c1-3-26-20(23)15-5-7-17(8-6-15)22-12-16(11-21)18-10-14(4-9-19(18)22)13-27(2,24)25/h4-10,12H,3,13H2,1-2H3
InChIKeyDIVDRRZHLYBNGP-UHFFFAOYSA-N
MW382.44 g/mol
LogP3.22
Rot. Bonds5

About ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate

ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate (PubChem CID 58437251) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate.

Molecular Properties

Compound Nameethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate
PubChem CID58437251
Molecular FormulaC20H18N2O4S
Molecular Weight382.44 g/mol
Exact Mass382.10
IUPAC Nameethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate
SMILESCCOC(=O)c1ccc(-n2cc(C#N)c3cc(CS(C)(=O)=O)ccc32)cc1
InChIInChI=1S/C20H18N2O4S/c1-3-26-20(23)15-5-7-17(8-6-15)22-12-16(11-21)18-10-14(4-9-19(18)22)13-27(2,24)25/h4-10,12H,3,13H2,1-2H3
InChIKeyDIVDRRZHLYBNGP-UHFFFAOYSA-N
XLogP3.22
TPSA89.16 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500382.44
LogP ≤ 53.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate?
The IUPAC name of ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate (CID 58437251) is ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate.
What is the SMILES notation for ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate?
The canonical SMILES for ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate is CCOC(=O)c1ccc(-n2cc(C#N)c3cc(CS(C)(=O)=O)ccc32)cc1.
What is the InChIKey of ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate?
The InChIKey is DIVDRRZHLYBNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4S/c1-3-26-20(23)15-5-7-17(8-6-15)22-12-16(11-21)18-10-14(4-9-19(18)22)13-27(2,24)25/h4-10,12H,3,13H2,1-2H3.
What are the key properties of ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate?
ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate has a molecular weight of 382.44 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate is sourced from PubChem (CID 58437251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).