C20H18N2O4S — CID 58437251
ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate (PubChem CID 58437251) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate |
|---|---|
| PubChem CID | 58437251 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | ethyl 4-[3-cyano-5-(methylsulfonylmethyl)indol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3cc(CS(C)(=O)=O)ccc32)cc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-3-26-20(23)15-5-7-17(8-6-15)22-12-16(11-21)18-10-14(4-9-19(18)22)13-27(2,24)25/h4-10,12H,3,13H2,1-2H3 |
| InChIKey | DIVDRRZHLYBNGP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |