C18H12F2N2O3 — CID 58437226
ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-hydroxybenzoate (PubChem CID 58437226) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-hydroxybenzoate.
| Compound Name | ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 58437226 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-hydroxybenzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3cc(F)c(F)cc32)cc1O |
| InChI | InChI=1S/C18H12F2N2O3/c1-2-25-18(24)12-4-3-11(5-17(12)23)22-9-10(8-21)13-6-14(19)15(20)7-16(13)22/h3-7,9,23H,2H2,1H3 |
| InChIKey | WUUXXGCMCNMGJM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |