C21H20N2O5 — CID 145493914
methyl 4-[3-cyano-5-(2-methoxyethoxy)-6-methylindol-1-yl]-2-hydroxybenzoate (PubChem CID 145493914) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl 4-[3-cyano-5-(2-methoxyethoxy)-6-methylindol-1-yl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[3-cyano-5-(2-methoxyethoxy)-6-methylindol-1-yl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 145493914 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl 4-[3-cyano-5-(2-methoxyethoxy)-6-methylindol-1-yl]-2-hydroxybenzoate |
| SMILES | COCCOc1cc2c(C#N)cn(-c3ccc(C(=O)OC)c(O)c3)c2cc1C |
| InChI | InChI=1S/C21H20N2O5/c1-13-8-18-17(10-20(13)28-7-6-26-2)14(11-22)12-23(18)15-4-5-16(19(24)9-15)21(25)27-3/h4-5,8-10,12,24H,6-7H2,1-3H3 |
| InChIKey | AJOHGYMQOWDHSM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|