C25H29N3O5 — CID 58437531
ethyl 4-[3-cyano-6-[3-(dimethylamino)propoxy]indol-1-yl]-2-(methoxymethoxy)benzoate (PubChem CID 58437531) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is ethyl 4-[3-cyano-6-[3-(dimethylamino)propoxy]indol-1-yl]-2-(methoxymethoxy)benzoate.
| Compound Name | ethyl 4-[3-cyano-6-[3-(dimethylamino)propoxy]indol-1-yl]-2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 58437531 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | ethyl 4-[3-cyano-6-[3-(dimethylamino)propoxy]indol-1-yl]-2-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3ccc(OCCCN(C)C)cc32)cc1OCOC |
| InChI | InChI=1S/C25H29N3O5/c1-5-31-25(29)22-9-7-19(13-24(22)33-17-30-4)28-16-18(15-26)21-10-8-20(14-23(21)28)32-12-6-11-27(2)3/h7-10,13-14,16H,5-6,11-12,17H2,1-4H3 |
| InChIKey | MFNVCGQVKKLMBJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|