C22H26N2O5 — CID 59478105
ethyl 4-[3-cyano-4-[2-(oxolan-2-yl)ethyl]pyrrol-1-yl]-2-(methoxymethoxy)benzoate (PubChem CID 59478105) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 4-[3-cyano-4-[2-(oxolan-2-yl)ethyl]pyrrol-1-yl]-2-(methoxymethoxy)benzoate.
| Compound Name | ethyl 4-[3-cyano-4-[2-(oxolan-2-yl)ethyl]pyrrol-1-yl]-2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 59478105 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | ethyl 4-[3-cyano-4-[2-(oxolan-2-yl)ethyl]pyrrol-1-yl]-2-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c(CCC3CCCO3)c2)cc1OCOC |
| InChI | InChI=1S/C22H26N2O5/c1-3-27-22(25)20-9-7-18(11-21(20)29-15-26-2)24-13-16(17(12-23)14-24)6-8-19-5-4-10-28-19/h7,9,11,13-14,19H,3-6,8,10,15H2,1-2H3 |
| InChIKey | GZNBWKOLAYJVBR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|