C19H20F3NO6 — CID 59477795
ethyl 1-[4-ethoxycarbonyl-3-(methoxymethoxy)phenyl]-4-(trifluoromethyl)pyrrole-3-carboxylate (PubChem CID 59477795) has the molecular formula C19H20F3NO6 and a molecular weight of 415.36 g/mol. Its IUPAC name is ethyl 1-[4-ethoxycarbonyl-3-(methoxymethoxy)phenyl]-4-(trifluoromethyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[4-ethoxycarbonyl-3-(methoxymethoxy)phenyl]-4-(trifluoromethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 59477795 |
| Molecular Formula | C19H20F3NO6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 1-[4-ethoxycarbonyl-3-(methoxymethoxy)phenyl]-4-(trifluoromethyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C(=O)OCC)c(C(F)(F)F)c2)cc1OCOC |
| InChI | InChI=1S/C19H20F3NO6/c1-4-27-17(24)13-7-6-12(8-16(13)29-11-26-3)23-9-14(18(25)28-5-2)15(10-23)19(20,21)22/h6-10H,4-5,11H2,1-3H3 |
| InChIKey | OJCKXPCONZTHDW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|