C21H16N2O4 — CID 59478047
4-[3-cyano-4-[(E)-2-(2-methoxyphenyl)ethenyl]pyrrol-1-yl]-2-hydroxybenzoic acid (PubChem CID 59478047) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-[3-cyano-4-[(E)-2-(2-methoxyphenyl)ethenyl]pyrrol-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-cyano-4-[(E)-2-(2-methoxyphenyl)ethenyl]pyrrol-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 59478047 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[3-cyano-4-[(E)-2-(2-methoxyphenyl)ethenyl]pyrrol-1-yl]-2-hydroxybenzoic acid |
| SMILES | COc1ccccc1/C=C/c1cn(-c2ccc(C(=O)O)c(O)c2)cc1C#N |
| InChI | InChI=1S/C21H16N2O4/c1-27-20-5-3-2-4-14(20)6-7-15-12-23(13-16(15)11-22)17-8-9-18(21(25)26)19(24)10-17/h2-10,12-13,24H,1H3,(H,25,26)/b7-6+ |
| InChIKey | YDFHAOUAESKQSU-VOTSOKGWSA-N |
| XLogP | 3.93 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |