4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid

C23H16N2O4 — CID 25052185

IUPAC4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid
SMILESN#Cc1cn(-c2ccc(C(=O)O)c(O)c2)c2cc(OCc3ccccc3)ccc12
InChIInChI=1S/C23H16N2O4/c24-12-16-13-25(17-6-8-20(23(27)28)22(26)10-17)21-11-18(7-9-19(16)21)29-14-15-4-2-1-3-5-15/h1-11,13,26H,14H2,(H,27,28)
InChIKeyDDBNPBGQDSXOAB-UHFFFAOYSA-N
MW384.39 g/mol
LogP4.48
Rot. Bonds5

About 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid

4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid (PubChem CID 25052185) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid.

Molecular Properties

Compound Name4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid
PubChem CID25052185
Molecular FormulaC23H16N2O4
Molecular Weight384.39 g/mol
Exact Mass384.11
IUPAC Name4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid
SMILESN#Cc1cn(-c2ccc(C(=O)O)c(O)c2)c2cc(OCc3ccccc3)ccc12
InChIInChI=1S/C23H16N2O4/c24-12-16-13-25(17-6-8-20(23(27)28)22(26)10-17)21-11-18(7-9-19(16)21)29-14-15-4-2-1-3-5-15/h1-11,13,26H,14H2,(H,27,28)
InChIKeyDDBNPBGQDSXOAB-UHFFFAOYSA-N
XLogP4.48
TPSA95.48 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms29
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500384.39
LogP ≤ 54.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid?
The IUPAC name of 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid (CID 25052185) is 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid.
What is the SMILES notation for 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid?
The canonical SMILES for 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid is N#Cc1cn(-c2ccc(C(=O)O)c(O)c2)c2cc(OCc3ccccc3)ccc12.
What is the InChIKey of 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid?
The InChIKey is DDBNPBGQDSXOAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O4/c24-12-16-13-25(17-6-8-20(23(27)28)22(26)10-17)21-11-18(7-9-19(16)21)29-14-15-4-2-1-3-5-15/h1-11,13,26H,14H2,(H,27,28).
What are the key properties of 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid?
4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid has a molecular weight of 384.39 g/mol, XLogP of 4.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid is sourced from PubChem (CID 25052185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).