C23H16N2O4 — CID 25052185
4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid (PubChem CID 25052185) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid.
| Compound Name | 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 25052185 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-(3-cyano-6-phenylmethoxyindol-1-yl)-2-hydroxybenzoic acid |
| SMILES | N#Cc1cn(-c2ccc(C(=O)O)c(O)c2)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C23H16N2O4/c24-12-16-13-25(17-6-8-20(23(27)28)22(26)10-17)21-11-18(7-9-19(16)21)29-14-15-4-2-1-3-5-15/h1-11,13,26H,14H2,(H,27,28) |
| InChIKey | DDBNPBGQDSXOAB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |