C25H23N3O4 — CID 59477595
ethyl 4-[3-cyano-4-(1-methylindol-3-yl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate (PubChem CID 59477595) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is ethyl 4-[3-cyano-4-(1-methylindol-3-yl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate.
| Compound Name | ethyl 4-[3-cyano-4-(1-methylindol-3-yl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 59477595 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | ethyl 4-[3-cyano-4-(1-methylindol-3-yl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c(-c3cn(C)c4ccccc34)c2)cc1OCOC |
| InChI | InChI=1S/C25H23N3O4/c1-4-31-25(29)20-10-9-18(11-24(20)32-16-30-3)28-13-17(12-26)21(15-28)22-14-27(2)23-8-6-5-7-19(22)23/h5-11,13-15H,4,16H2,1-3H3 |
| InChIKey | RPYDJPYLUDZMQA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|