C17H14N2O4S — CID 141420239
4-(6-cyano-2-methylthieno[3,2-b]pyrrol-4-yl)-2-(methoxymethoxy)benzoic acid (PubChem CID 141420239) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-(6-cyano-2-methylthieno[3,2-b]pyrrol-4-yl)-2-(methoxymethoxy)benzoic acid.
| Compound Name | 4-(6-cyano-2-methylthieno[3,2-b]pyrrol-4-yl)-2-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 141420239 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-(6-cyano-2-methylthieno[3,2-b]pyrrol-4-yl)-2-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1cc(-n2cc(C#N)c3sc(C)cc32)ccc1C(=O)O |
| InChI | InChI=1S/C17H14N2O4S/c1-10-5-14-16(24-10)11(7-18)8-19(14)12-3-4-13(17(20)21)15(6-12)23-9-22-2/h3-6,8H,9H2,1-2H3,(H,20,21) |
| InChIKey | MIMLCJSZGGMJNA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|