C23H22N2O7 — CID 58437333
ethyl 4-[3-cyano-6-(2-methoxy-2-oxoethoxy)indol-1-yl]-2-(methoxymethoxy)benzoate (PubChem CID 58437333) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is ethyl 4-[3-cyano-6-(2-methoxy-2-oxoethoxy)indol-1-yl]-2-(methoxymethoxy)benzoate.
| Compound Name | ethyl 4-[3-cyano-6-(2-methoxy-2-oxoethoxy)indol-1-yl]-2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 58437333 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | ethyl 4-[3-cyano-6-(2-methoxy-2-oxoethoxy)indol-1-yl]-2-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3ccc(OCC(=O)OC)cc32)cc1OCOC |
| InChI | InChI=1S/C23H22N2O7/c1-4-30-23(27)19-7-5-16(9-21(19)32-14-28-2)25-12-15(11-24)18-8-6-17(10-20(18)25)31-13-22(26)29-3/h5-10,12H,4,13-14H2,1-3H3 |
| InChIKey | QGEACYMYJAZTTB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|