C23H21FN2O5 — CID 59477991
ethyl 4-[3-cyano-4-(2-fluoro-4-methoxyphenyl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate (PubChem CID 59477991) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is ethyl 4-[3-cyano-4-(2-fluoro-4-methoxyphenyl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate.
| Compound Name | ethyl 4-[3-cyano-4-(2-fluoro-4-methoxyphenyl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 59477991 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | ethyl 4-[3-cyano-4-(2-fluoro-4-methoxyphenyl)pyrrol-1-yl]-2-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c(-c3ccc(OC)cc3F)c2)cc1OCOC |
| InChI | InChI=1S/C23H21FN2O5/c1-4-30-23(27)19-7-5-16(9-22(19)31-14-28-2)26-12-15(11-25)20(13-26)18-8-6-17(29-3)10-21(18)24/h5-10,12-13H,4,14H2,1-3H3 |
| InChIKey | MXPZRSRDELOUMA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|