C20H15F3N2O6S — CID 86639602
ethyl 4-[3-cyano-5-methoxy-6-(trifluoromethylsulfonyloxy)indol-1-yl]benzoate (PubChem CID 86639602) has the molecular formula C20H15F3N2O6S and a molecular weight of 468.41 g/mol. Its IUPAC name is ethyl 4-[3-cyano-5-methoxy-6-(trifluoromethylsulfonyloxy)indol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-cyano-5-methoxy-6-(trifluoromethylsulfonyloxy)indol-1-yl]benzoate |
|---|---|
| PubChem CID | 86639602 |
| Molecular Formula | C20H15F3N2O6S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | ethyl 4-[3-cyano-5-methoxy-6-(trifluoromethylsulfonyloxy)indol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3cc(OC)c(OS(=O)(=O)C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C20H15F3N2O6S/c1-3-30-19(26)12-4-6-14(7-5-12)25-11-13(10-24)15-8-17(29-2)18(9-16(15)25)31-32(27,28)20(21,22)23/h4-9,11H,3H2,1-2H3 |
| InChIKey | LBKRHCZZELMCBC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 107.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|