C27H23N3O3 — CID 58437553
ethyl 4-[5-[benzyl(methyl)carbamoyl]-3-cyanoindol-1-yl]benzoate (PubChem CID 58437553) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is ethyl 4-[5-[benzyl(methyl)carbamoyl]-3-cyanoindol-1-yl]benzoate.
| Compound Name | ethyl 4-[5-[benzyl(methyl)carbamoyl]-3-cyanoindol-1-yl]benzoate |
|---|---|
| PubChem CID | 58437553 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | ethyl 4-[5-[benzyl(methyl)carbamoyl]-3-cyanoindol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3cc(C(=O)N(C)Cc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C27H23N3O3/c1-3-33-27(32)20-9-12-23(13-10-20)30-18-22(16-28)24-15-21(11-14-25(24)30)26(31)29(2)17-19-7-5-4-6-8-19/h4-15,18H,3,17H2,1-2H3 |
| InChIKey | YFWMVHZPAPXMDM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |