C16H9FN2O3 — CID 58437488
4-(3-cyano-6-fluoro-5-hydroxyindol-1-yl)benzoic acid (PubChem CID 58437488) has the molecular formula C16H9FN2O3 and a molecular weight of 296.26 g/mol. Its IUPAC name is 4-(3-cyano-6-fluoro-5-hydroxyindol-1-yl)benzoic acid.
| Compound Name | 4-(3-cyano-6-fluoro-5-hydroxyindol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 58437488 |
| Molecular Formula | C16H9FN2O3 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-(3-cyano-6-fluoro-5-hydroxyindol-1-yl)benzoic acid |
| SMILES | N#Cc1cn(-c2ccc(C(=O)O)cc2)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C16H9FN2O3/c17-13-6-14-12(5-15(13)20)10(7-18)8-19(14)11-3-1-9(2-4-11)16(21)22/h1-6,8,20H,(H,21,22) |
| InChIKey | GFVCYAYBSHQWJV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |