C17H10F3N5O3S — CID 1043290
N'-(furan-2-carbonyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 1043290) has the molecular formula C17H10F3N5O3S and a molecular weight of 421.36 g/mol. Its IUPAC name is N'-(furan-2-carbonyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | N'-(furan-2-carbonyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 1043290 |
| Molecular Formula | C17H10F3N5O3S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N'-(furan-2-carbonyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccco1)c1cc2nc(-c3cccs3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C17H10F3N5O3S/c18-17(19,20)13-7-9(12-4-2-6-29-12)21-14-8-10(24-25(13)14)15(26)22-23-16(27)11-3-1-5-28-11/h1-8H,(H,22,26)(H,23,27) |
| InChIKey | DQTNUBYVROQITJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|