C18H19F3N4O2S — CID 19453804
N-(3-propan-2-yloxypropyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19453804) has the molecular formula C18H19F3N4O2S and a molecular weight of 412.44 g/mol. Its IUPAC name is N-(3-propan-2-yloxypropyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(3-propan-2-yloxypropyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19453804 |
| Molecular Formula | C18H19F3N4O2S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(3-propan-2-yloxypropyl)-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1cc2nc(-c3cccs3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C18H19F3N4O2S/c1-11(2)27-7-4-6-22-17(26)13-10-16-23-12(14-5-3-8-28-14)9-15(18(19,20)21)25(16)24-13/h3,5,8-11H,4,6-7H2,1-2H3,(H,22,26) |
| InChIKey | SXDCKSLYMUPSAL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|