C28H49NO5 — CID 10435264
3-O-tert-butyl 5-O-(2,2-dimethyloct-7-en-4-yl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate (PubChem CID 10435264) has the molecular formula C28H49NO5 and a molecular weight of 479.70 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-(2,2-dimethyloct-7-en-4-yl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-(2,2-dimethyloct-7-en-4-yl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10435264 |
| Molecular Formula | C28H49NO5 |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 479.36 |
| IUPAC Name | 3-O-tert-butyl 5-O-(2,2-dimethyloct-7-en-4-yl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate |
| SMILES | C=CCCC(CC(C)(C)C)OC(=O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C28H49NO5/c1-10-11-17-21(19-26(2,3)4)32-24(30)23-22(18-20-15-13-12-14-16-20)29(28(8,9)33-23)25(31)34-27(5,6)7/h10,20-23H,1,11-19H2,2-9H3/t21?,22-,23+/m0/s1 |
| InChIKey | IVDNIIWFKUHMKX-ATTQYFOMSA-N |
| XLogP | 7.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|